C17H22N4OS — CID 142255276
azane;1,7-dimethyl-5-phenyl-3H-1,4-benzodiazepin-2-one;thiohydroxylamine (PubChem CID 142255276) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is azane;1,7-dimethyl-5-phenyl-3H-1,4-benzodiazepin-2-one;thiohydroxylamine.
| Compound Name | azane;1,7-dimethyl-5-phenyl-3H-1,4-benzodiazepin-2-one;thiohydroxylamine |
|---|---|
| PubChem CID | 142255276 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | azane;1,7-dimethyl-5-phenyl-3H-1,4-benzodiazepin-2-one;thiohydroxylamine |
| SMILES | Cc1ccc2c(c1)C(c1ccccc1)=NCC(=O)N2C.N.NS |
| InChI | InChI=1S/C17H16N2O.H3NS.H3N/c1-12-8-9-15-14(10-12)17(13-6-4-3-5-7-13)18-11-16(20)19(15)2;1-2;/h3-10H,11H2,1-2H3;2H,1H2;1H3 |
| InChIKey | HFVSCMQDYIINMM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|