C19H20N2O — CID 619356
1-ethyl-8-methyl-6-phenyl-3,4-dihydro-1,5-benzodiazocin-2-one (PubChem CID 619356) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-ethyl-8-methyl-6-phenyl-3,4-dihydro-1,5-benzodiazocin-2-one.
| Compound Name | 1-ethyl-8-methyl-6-phenyl-3,4-dihydro-1,5-benzodiazocin-2-one |
|---|---|
| PubChem CID | 619356 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1-ethyl-8-methyl-6-phenyl-3,4-dihydro-1,5-benzodiazocin-2-one |
| SMILES | CCN1C(=O)CC/N=C(/c2ccccc2)c2cc(C)ccc21 |
| InChI | InChI=1S/C19H20N2O/c1-3-21-17-10-9-14(2)13-16(17)19(20-12-11-18(21)22)15-7-5-4-6-8-15/h4-10,13H,3,11-12H2,1-2H3/b20-19- |
| InChIKey | PJJCITGRURDNGV-VXPUYCOJSA-N |
| XLogP | 3.59 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |