C20H19ClN2O — CID 154138660
7-chloro-1-(cyclobutylmethyl)-5-phenyl-3H-1,4-benzodiazepin-2-one (PubChem CID 154138660) has the molecular formula C20H19ClN2O and a molecular weight of 338.84 g/mol. Its IUPAC name is 7-chloro-1-(cyclobutylmethyl)-5-phenyl-3H-1,4-benzodiazepin-2-one.
| Compound Name | 7-chloro-1-(cyclobutylmethyl)-5-phenyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 154138660 |
| Molecular Formula | C20H19ClN2O |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 7-chloro-1-(cyclobutylmethyl)-5-phenyl-3H-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN=C(c2ccccc2)c2cc(Cl)ccc2N1CC1CCC1 |
| InChI | InChI=1S/C20H19ClN2O/c21-16-9-10-18-17(11-16)20(15-7-2-1-3-8-15)22-12-19(24)23(18)13-14-5-4-6-14/h1-3,7-11,14H,4-6,12-13H2 |
| InChIKey | SNJUJTDQLVLRNQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |