C20H23Cl2N3O — CID 175667528
2-(7-chloro-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)ethyl-trimethylazanium chloride (PubChem CID 175667528) has the molecular formula C20H23Cl2N3O and a molecular weight of 392.33 g/mol. Its IUPAC name is 2-(7-chloro-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)ethyl-trimethylazanium chloride.
| Compound Name | 2-(7-chloro-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)ethyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 175667528 |
| Molecular Formula | C20H23Cl2N3O |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-(7-chloro-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)ethyl-trimethylazanium chloride |
| SMILES | C[N+](C)(C)CCN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21.[Cl-] |
| InChI | InChI=1S/C20H23ClN3O.ClH/c1-24(2,3)12-11-23-18-10-9-16(21)13-17(18)20(22-14-19(23)25)15-7-5-4-6-8-15;/h4-10,13H,11-12,14H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | KLEYTFJDTQWUNE-UHFFFAOYSA-M |
| XLogP | 0.23 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|