C22H18ClFN2O — CID 174861509
7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one;fluorobenzene (PubChem CID 174861509) has the molecular formula C22H18ClFN2O and a molecular weight of 380.85 g/mol. Its IUPAC name is 7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one;fluorobenzene.
| Compound Name | 7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one;fluorobenzene |
|---|---|
| PubChem CID | 174861509 |
| Molecular Formula | C22H18ClFN2O |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one;fluorobenzene |
| SMILES | CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21.Fc1ccccc1 |
| InChI | InChI=1S/C16H13ClN2O.C6H5F/c1-19-14-8-7-12(17)9-13(14)16(18-10-15(19)20)11-5-3-2-4-6-11;7-6-4-2-1-3-5-6/h2-9H,10H2,1H3;1-5H |
| InChIKey | XHIMISRZINIYJN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |