C19H19ClN2O — CID 620747
8-chloro-6-phenyl-1-propyl-3,4-dihydro-1,5-benzodiazocin-2-one (PubChem CID 620747) has the molecular formula C19H19ClN2O and a molecular weight of 326.83 g/mol. Its IUPAC name is 8-chloro-6-phenyl-1-propyl-3,4-dihydro-1,5-benzodiazocin-2-one.
| Compound Name | 8-chloro-6-phenyl-1-propyl-3,4-dihydro-1,5-benzodiazocin-2-one |
|---|---|
| PubChem CID | 620747 |
| Molecular Formula | C19H19ClN2O |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 8-chloro-6-phenyl-1-propyl-3,4-dihydro-1,5-benzodiazocin-2-one |
| SMILES | CCCN1C(=O)CC/N=C(/c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H19ClN2O/c1-2-12-22-17-9-8-15(20)13-16(17)19(21-11-10-18(22)23)14-6-4-3-5-7-14/h3-9,13H,2,10-12H2,1H3/b21-19- |
| InChIKey | MQVKOULZESCGIG-VZCXRCSSSA-N |
| XLogP | 4.32 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |