C18H17N3O4 — CID 154094936
1-(ethoxymethyl)-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one (PubChem CID 154094936) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 1-(ethoxymethyl)-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one.
| Compound Name | 1-(ethoxymethyl)-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 154094936 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-(ethoxymethyl)-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one |
| SMILES | CCOCN1C(=O)CN=C(c2ccccc2)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C18H17N3O4/c1-2-25-12-20-16-9-8-14(21(23)24)10-15(16)18(19-11-17(20)22)13-6-4-3-5-7-13/h3-10H,2,11-12H2,1H3 |
| InChIKey | ZEKCCTITMKRCDA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|