C19H15N5O4 — CID 19865828
(8-nitro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)methyl acetate (PubChem CID 19865828) has the molecular formula C19H15N5O4 and a molecular weight of 377.36 g/mol. Its IUPAC name is (8-nitro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)methyl acetate.
| Compound Name | (8-nitro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)methyl acetate |
|---|---|
| PubChem CID | 19865828 |
| Molecular Formula | C19H15N5O4 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | (8-nitro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)methyl acetate |
| SMILES | CC(=O)OCc1nnc2n1-c1ccc([N+](=O)[O-])cc1C(c1ccccc1)=NC2 |
| InChI | InChI=1S/C19H15N5O4/c1-12(25)28-11-18-22-21-17-10-20-19(13-5-3-2-4-6-13)15-9-14(24(26)27)7-8-16(15)23(17)18/h2-9H,10-11H2,1H3 |
| InChIKey | BJRBYKKOEYKYSO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 112.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|