C17H12FN5O3 — CID 21450833
[6-(2-fluorophenyl)-8-nitro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]methanol (PubChem CID 21450833) has the molecular formula C17H12FN5O3 and a molecular weight of 353.31 g/mol. Its IUPAC name is [6-(2-fluorophenyl)-8-nitro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]methanol.
| Compound Name | [6-(2-fluorophenyl)-8-nitro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]methanol |
|---|---|
| PubChem CID | 21450833 |
| Molecular Formula | C17H12FN5O3 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | [6-(2-fluorophenyl)-8-nitro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl]methanol |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C(c1ccccc1F)=NCc1nnc(CO)n1-2 |
| InChI | InChI=1S/C17H12FN5O3/c18-13-4-2-1-3-11(13)17-12-7-10(23(25)26)5-6-14(12)22-15(8-19-17)20-21-16(22)9-24/h1-7,24H,8-9H2 |
| InChIKey | OLGJAJLDSVGQMX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|