C18H12ClN5O4 — CID 21441598
7-(2-chlorophenyl)-2-(hydroxymethyl)-10-nitro-5H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-1-one (PubChem CID 21441598) has the molecular formula C18H12ClN5O4 and a molecular weight of 397.78 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-2-(hydroxymethyl)-10-nitro-5H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-1-one.
| Compound Name | 7-(2-chlorophenyl)-2-(hydroxymethyl)-10-nitro-5H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-1-one |
|---|---|
| PubChem CID | 21441598 |
| Molecular Formula | C18H12ClN5O4 |
| Molecular Weight | 397.78 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 7-(2-chlorophenyl)-2-(hydroxymethyl)-10-nitro-5H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-1-one |
| SMILES | O=c1c(CO)nnc2n1-c1cc([N+](=O)[O-])ccc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C18H12ClN5O4/c19-13-4-2-1-3-11(13)17-12-6-5-10(24(27)28)7-15(12)23-16(8-20-17)22-21-14(9-25)18(23)26/h1-7,25H,8-9H2 |
| InChIKey | ROAMZUHGYYAXHN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.78 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|