C18H17N7O2 — CID 70090326
N,N-dimethyl-1-(9-nitro-6-pyridin-2-yl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)methanamine (PubChem CID 70090326) has the molecular formula C18H17N7O2 and a molecular weight of 363.38 g/mol. Its IUPAC name is N,N-dimethyl-1-(9-nitro-6-pyridin-2-yl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(9-nitro-6-pyridin-2-yl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)methanamine |
|---|---|
| PubChem CID | 70090326 |
| Molecular Formula | C18H17N7O2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N,N-dimethyl-1-(9-nitro-6-pyridin-2-yl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)methanamine |
| SMILES | CN(C)Cc1nnc2n1-c1cc([N+](=O)[O-])ccc1C(c1ccccn1)=NC2 |
| InChI | InChI=1S/C18H17N7O2/c1-23(2)11-17-22-21-16-10-20-18(14-5-3-4-8-19-14)13-7-6-12(25(26)27)9-15(13)24(16)17/h3-9H,10-11H2,1-2H3 |
| InChIKey | KZSSHOGMMUYYMR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 102.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|