C16H12ClN5 — CID 21495139
1-(chloromethyl)-6-pyridin-2-yl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 21495139) has the molecular formula C16H12ClN5 and a molecular weight of 309.76 g/mol. Its IUPAC name is 1-(chloromethyl)-6-pyridin-2-yl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 1-(chloromethyl)-6-pyridin-2-yl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 21495139 |
| Molecular Formula | C16H12ClN5 |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 1-(chloromethyl)-6-pyridin-2-yl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | ClCc1nnc2n1-c1ccccc1C(c1ccccn1)=NC2 |
| InChI | InChI=1S/C16H12ClN5/c17-9-14-20-21-15-10-19-16(12-6-3-4-8-18-12)11-5-1-2-7-13(11)22(14)15/h1-8H,9-10H2 |
| InChIKey | HINGQJGDWIPMRU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|