C17H11ClFN5O2 — CID 21437312
1-(chloromethyl)-6-(2-fluorophenyl)-7-nitro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 21437312) has the molecular formula C17H11ClFN5O2 and a molecular weight of 371.76 g/mol. Its IUPAC name is 1-(chloromethyl)-6-(2-fluorophenyl)-7-nitro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 1-(chloromethyl)-6-(2-fluorophenyl)-7-nitro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 21437312 |
| Molecular Formula | C17H11ClFN5O2 |
| Molecular Weight | 371.76 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 1-(chloromethyl)-6-(2-fluorophenyl)-7-nitro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | O=[N+]([O-])c1cccc2c1C(c1ccccc1F)=NCc1nnc(CCl)n1-2 |
| InChI | InChI=1S/C17H11ClFN5O2/c18-8-14-21-22-15-9-20-17(10-4-1-2-5-11(10)19)16-12(23(14)15)6-3-7-13(16)24(25)26/h1-7H,8-9H2 |
| InChIKey | UCCTYYHWNQEKHZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 86.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.76 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|