C20H13F2N5O3 — CID 21441668
7-(2,6-difluorophenyl)-9-nitro-2-prop-2-enyl-5H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-1-one (PubChem CID 21441668) has the molecular formula C20H13F2N5O3 and a molecular weight of 409.35 g/mol. Its IUPAC name is 7-(2,6-difluorophenyl)-9-nitro-2-prop-2-enyl-5H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-1-one.
| Compound Name | 7-(2,6-difluorophenyl)-9-nitro-2-prop-2-enyl-5H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-1-one |
|---|---|
| PubChem CID | 21441668 |
| Molecular Formula | C20H13F2N5O3 |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 7-(2,6-difluorophenyl)-9-nitro-2-prop-2-enyl-5H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-1-one |
| SMILES | C=CCc1nnc2n(c1=O)-c1ccc([N+](=O)[O-])cc1C(c1c(F)cccc1F)=NC2 |
| InChI | InChI=1S/C20H13F2N5O3/c1-2-4-15-20(28)26-16-8-7-11(27(29)30)9-12(16)19(23-10-17(26)25-24-15)18-13(21)5-3-6-14(18)22/h2-3,5-9H,1,4,10H2 |
| InChIKey | QWYCFSAUWJDXBT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 103.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|