C17H14FN3O3 — CID 174351071
5-(2-fluorophenyl)-1-methyl-7-nitro-2,3-dihydro-1,4-benzodiazepine-2-carbaldehyde (PubChem CID 174351071) has the molecular formula C17H14FN3O3 and a molecular weight of 327.32 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-1-methyl-7-nitro-2,3-dihydro-1,4-benzodiazepine-2-carbaldehyde.
| Compound Name | 5-(2-fluorophenyl)-1-methyl-7-nitro-2,3-dihydro-1,4-benzodiazepine-2-carbaldehyde |
|---|---|
| PubChem CID | 174351071 |
| Molecular Formula | C17H14FN3O3 |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 5-(2-fluorophenyl)-1-methyl-7-nitro-2,3-dihydro-1,4-benzodiazepine-2-carbaldehyde |
| SMILES | CN1c2ccc([N+](=O)[O-])cc2C(c2ccccc2F)=NCC1C=O |
| InChI | InChI=1S/C17H14FN3O3/c1-20-12(10-22)9-19-17(13-4-2-3-5-15(13)18)14-8-11(21(23)24)6-7-16(14)20/h2-8,10,12H,9H2,1H3 |
| InChIKey | PKEQKNBTUVHIES-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|