C15H11FN4O2 — CID 21266006
5-(2-fluorophenyl)-7-nitro-3H-1,4-benzodiazepin-2-amine (PubChem CID 21266006) has the molecular formula C15H11FN4O2 and a molecular weight of 298.28 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-7-nitro-3H-1,4-benzodiazepin-2-amine.
| Compound Name | 5-(2-fluorophenyl)-7-nitro-3H-1,4-benzodiazepin-2-amine |
|---|---|
| PubChem CID | 21266006 |
| Molecular Formula | C15H11FN4O2 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 5-(2-fluorophenyl)-7-nitro-3H-1,4-benzodiazepin-2-amine |
| SMILES | NC1=Nc2ccc([N+](=O)[O-])cc2C(c2ccccc2F)=NC1 |
| InChI | InChI=1S/C15H11FN4O2/c16-12-4-2-1-3-10(12)15-11-7-9(20(21)22)5-6-13(11)19-14(17)8-18-15/h1-7H,8H2,(H2,17,19) |
| InChIKey | VMIJSMTXYHNZBK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|