C15H10N4O5 — CID 23276342
7-nitro-5-(2-nitrophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 23276342) has the molecular formula C15H10N4O5 and a molecular weight of 326.27 g/mol. Its IUPAC name is 7-nitro-5-(2-nitrophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 7-nitro-5-(2-nitrophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 23276342 |
| Molecular Formula | C15H10N4O5 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 7-nitro-5-(2-nitrophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN=C(c2ccccc2[N+](=O)[O-])c2cc([N+](=O)[O-])ccc2N1 |
| InChI | InChI=1S/C15H10N4O5/c20-14-8-16-15(10-3-1-2-4-13(10)19(23)24)11-7-9(18(21)22)5-6-12(11)17-14/h1-7H,8H2,(H,17,20) |
| InChIKey | OJELCBFEIURAEP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|