C15H9ClFN3O3 — CID 23332704
5-(2-chlorophenyl)-3-fluoro-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 23332704) has the molecular formula C15H9ClFN3O3 and a molecular weight of 333.71 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-3-fluoro-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 5-(2-chlorophenyl)-3-fluoro-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 23332704 |
| Molecular Formula | C15H9ClFN3O3 |
| Molecular Weight | 333.71 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 5-(2-chlorophenyl)-3-fluoro-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | O=C1Nc2ccc([N+](=O)[O-])cc2C(c2ccccc2Cl)=NC1F |
| InChI | InChI=1S/C15H9ClFN3O3/c16-11-4-2-1-3-9(11)13-10-7-8(20(22)23)5-6-12(10)18-15(21)14(17)19-13/h1-7,14H,(H,18,21) |
| InChIKey | KCXRVDGFQFGETR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.71 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|