C30H20Cl2N6O6 — CID 87845370
5-(2-chlorophenyl)-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 87845370) has the molecular formula C30H20Cl2N6O6 and a molecular weight of 631.43 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 5-(2-chlorophenyl)-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 87845370 |
| Molecular Formula | C30H20Cl2N6O6 |
| Molecular Weight | 631.43 g/mol |
| Exact Mass | 630.08 |
| IUPAC Name | 5-(2-chlorophenyl)-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN=C(c2ccccc2Cl)c2cc([N+](=O)[O-])ccc2N1.O=C1CN=C(c2ccccc2Cl)c2cc([N+](=O)[O-])ccc2N1 |
| InChI | InChI=1S/2C15H10ClN3O3/c2*16-12-4-2-1-3-10(12)15-11-7-9(19(21)22)5-6-13(11)18-14(20)8-17-15/h2*1-7H,8H2,(H,18,20) |
| InChIKey | HVZKFUYPRPAHIT-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 169.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.43 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|