C16H12ClN5O3 — CID 152781710
5-(2-chlorophenyl)-7-nitro-N-(nitrosomethyl)-1,3-dihydro-1,4-benzodiazepin-2-imine (PubChem CID 152781710) has the molecular formula C16H12ClN5O3 and a molecular weight of 357.76 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-7-nitro-N-(nitrosomethyl)-1,3-dihydro-1,4-benzodiazepin-2-imine.
| Compound Name | 5-(2-chlorophenyl)-7-nitro-N-(nitrosomethyl)-1,3-dihydro-1,4-benzodiazepin-2-imine |
|---|---|
| PubChem CID | 152781710 |
| Molecular Formula | C16H12ClN5O3 |
| Molecular Weight | 357.76 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 5-(2-chlorophenyl)-7-nitro-N-(nitrosomethyl)-1,3-dihydro-1,4-benzodiazepin-2-imine |
| SMILES | O=NCN=C1CN=C(c2ccccc2Cl)c2cc([N+](=O)[O-])ccc2N1 |
| InChI | InChI=1S/C16H12ClN5O3/c17-13-4-2-1-3-11(13)16-12-7-10(22(24)25)5-6-14(12)21-15(8-18-16)19-9-20-23/h1-7H,8-9H2,(H,19,21) |
| InChIKey | CWARBGBMVWXZNY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.76 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|