C18H15BrClN5O3 — CID 88823049
(2E)-3-bromo-2-[[5-(2-chlorophenyl)-7-nitro-3H-1,4-benzodiazepin-2-yl]hydrazinylidene]propan-1-ol (PubChem CID 88823049) has the molecular formula C18H15BrClN5O3 and a molecular weight of 464.71 g/mol. Its IUPAC name is (2E)-3-bromo-2-[[5-(2-chlorophenyl)-7-nitro-3H-1,4-benzodiazepin-2-yl]hydrazinylidene]propan-1-ol.
| Compound Name | (2E)-3-bromo-2-[[5-(2-chlorophenyl)-7-nitro-3H-1,4-benzodiazepin-2-yl]hydrazinylidene]propan-1-ol |
|---|---|
| PubChem CID | 88823049 |
| Molecular Formula | C18H15BrClN5O3 |
| Molecular Weight | 464.71 g/mol |
| Exact Mass | 463.00 |
| IUPAC Name | (2E)-3-bromo-2-[[5-(2-chlorophenyl)-7-nitro-3H-1,4-benzodiazepin-2-yl]hydrazinylidene]propan-1-ol |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C(c1ccccc1Cl)=NCC(N/N=C(\CO)CBr)=N2 |
| InChI | InChI=1S/C18H15BrClN5O3/c19-8-11(10-26)23-24-17-9-21-18(13-3-1-2-4-15(13)20)14-7-12(25(27)28)5-6-16(14)22-17/h1-7,26H,8-10H2,(H,22,24)/b23-11- |
| InChIKey | VVNXQSQDQGQTMQ-KSEXSDGBSA-N |
| XLogP | 3.46 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.71 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|