C22H22BrN5O4 — CID 173455502
ethyl 4-bromo-2-methyl-3-[(7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-yl)hydrazinylidene]butanoate (PubChem CID 173455502) has the molecular formula C22H22BrN5O4 and a molecular weight of 500.35 g/mol. Its IUPAC name is ethyl 4-bromo-2-methyl-3-[(7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-yl)hydrazinylidene]butanoate.
| Compound Name | ethyl 4-bromo-2-methyl-3-[(7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-yl)hydrazinylidene]butanoate |
|---|---|
| PubChem CID | 173455502 |
| Molecular Formula | C22H22BrN5O4 |
| Molecular Weight | 500.35 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | ethyl 4-bromo-2-methyl-3-[(7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-yl)hydrazinylidene]butanoate |
| SMILES | CCOC(=O)C(C)C(CBr)=NNC1=Nc2ccc([N+](=O)[O-])cc2C(c2ccccc2)=NC1 |
| InChI | InChI=1S/C22H22BrN5O4/c1-3-32-22(29)14(2)19(12-23)26-27-20-13-24-21(15-7-5-4-6-8-15)17-11-16(28(30)31)9-10-18(17)25-20/h4-11,14H,3,12-13H2,1-2H3,(H,25,27) |
| InChIKey | QZLWHJPMEJHSSN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 118.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|