C16H13ClKN3O3 — CID 67873195
potassium;1-methyl-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one;chloride (PubChem CID 67873195) has the molecular formula C16H13ClKN3O3 and a molecular weight of 369.85 g/mol. Its IUPAC name is potassium;1-methyl-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one;chloride.
| Compound Name | potassium;1-methyl-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one;chloride |
|---|---|
| PubChem CID | 67873195 |
| Molecular Formula | C16H13ClKN3O3 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | potassium;1-methyl-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one;chloride |
| SMILES | CN1C(=O)CN=C(c2ccccc2)c2cc([N+](=O)[O-])ccc21.[Cl-].[K+] |
| InChI | InChI=1S/C16H13N3O3.ClH.K/c1-18-14-8-7-12(19(21)22)9-13(14)16(17-10-15(18)20)11-5-3-2-4-6-11;;/h2-9H,10H2,1H3;1H;/q;;+1/p-1 |
| InChIKey | LTGQBPJHFVIKGO-UHFFFAOYSA-M |
| XLogP | -3.58 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|