C22H17ClN4O2 — CID 12785863
[(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-phenylcarbamate (PubChem CID 12785863) has the molecular formula C22H17ClN4O2 and a molecular weight of 404.86 g/mol. Its IUPAC name is [(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-phenylcarbamate.
| Compound Name | [(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-phenylcarbamate |
|---|---|
| PubChem CID | 12785863 |
| Molecular Formula | C22H17ClN4O2 |
| Molecular Weight | 404.86 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)ONC1=Nc2ccc(Cl)cc2C(c2ccccc2)=NC1 |
| InChI | InChI=1S/C22H17ClN4O2/c23-16-11-12-19-18(13-16)21(15-7-3-1-4-8-15)24-14-20(26-19)27-29-22(28)25-17-9-5-2-6-10-17/h1-13H,14H2,(H,25,28)(H,26,27) |
| InChIKey | FALWSFCLOMLUCL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.86 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|