C17H16ClN5O — CID 57397519
N'-(7-chloro-3-methyl-5-phenyl-1,3,4-benzotriazepin-2-yl)acetohydrazide (PubChem CID 57397519) has the molecular formula C17H16ClN5O and a molecular weight of 341.80 g/mol. Its IUPAC name is N'-(7-chloro-3-methyl-5-phenyl-1,3,4-benzotriazepin-2-yl)acetohydrazide.
| Compound Name | N'-(7-chloro-3-methyl-5-phenyl-1,3,4-benzotriazepin-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 57397519 |
| Molecular Formula | C17H16ClN5O |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N'-(7-chloro-3-methyl-5-phenyl-1,3,4-benzotriazepin-2-yl)acetohydrazide |
| SMILES | CC(=O)NNC1=Nc2ccc(Cl)cc2C(c2ccccc2)=NN1C |
| InChI | InChI=1S/C17H16ClN5O/c1-11(24)20-21-17-19-15-9-8-13(18)10-14(15)16(22-23(17)2)12-6-4-3-5-7-12/h3-10H,1-2H3,(H,19,21)(H,20,24) |
| InChIKey | SMNCMWPHYVMAAA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|