C21H16ClN5O — CID 136794981
N'-(7-chloro-5-phenyl-3H-1,3,4-benzotriazepin-2-yl)benzohydrazide (PubChem CID 136794981) has the molecular formula C21H16ClN5O and a molecular weight of 389.85 g/mol. Its IUPAC name is N'-(7-chloro-5-phenyl-3H-1,3,4-benzotriazepin-2-yl)benzohydrazide.
| Compound Name | N'-(7-chloro-5-phenyl-3H-1,3,4-benzotriazepin-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 136794981 |
| Molecular Formula | C21H16ClN5O |
| Molecular Weight | 389.85 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N'-(7-chloro-5-phenyl-3H-1,3,4-benzotriazepin-2-yl)benzohydrazide |
| SMILES | O=C(NNC1=Nc2ccc(Cl)cc2C(c2ccccc2)=NN1)c1ccccc1 |
| InChI | InChI=1S/C21H16ClN5O/c22-16-11-12-18-17(13-16)19(14-7-3-1-4-8-14)24-26-21(23-18)27-25-20(28)15-9-5-2-6-10-15/h1-13H,(H,25,28)(H2,23,26,27) |
| InChIKey | NGYUPPHUFMVEFI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.85 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|