C22H16ClN3O — CID 11854402
4-chloro-N'-(2-phenylquinolin-4-yl)benzohydrazide (PubChem CID 11854402) has the molecular formula C22H16ClN3O and a molecular weight of 373.84 g/mol. Its IUPAC name is 4-chloro-N'-(2-phenylquinolin-4-yl)benzohydrazide.
| Compound Name | 4-chloro-N'-(2-phenylquinolin-4-yl)benzohydrazide |
|---|---|
| PubChem CID | 11854402 |
| Molecular Formula | C22H16ClN3O |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 4-chloro-N'-(2-phenylquinolin-4-yl)benzohydrazide |
| SMILES | O=C(NNc1cc(-c2ccccc2)nc2ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16ClN3O/c23-17-12-10-16(11-13-17)22(27)26-25-21-14-20(15-6-2-1-3-7-15)24-19-9-5-4-8-18(19)21/h1-14H,(H,24,25)(H,26,27) |
| InChIKey | ACDGDLANEBKEAA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|