C20H13ClFN3 — CID 135403299
2-(4-chlorophenyl)-7-fluoro-5-phenyl-3H-1,3,4-benzotriazepine (PubChem CID 135403299) has the molecular formula C20H13ClFN3 and a molecular weight of 349.80 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-7-fluoro-5-phenyl-3H-1,3,4-benzotriazepine.
| Compound Name | 2-(4-chlorophenyl)-7-fluoro-5-phenyl-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135403299 |
| Molecular Formula | C20H13ClFN3 |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-(4-chlorophenyl)-7-fluoro-5-phenyl-3H-1,3,4-benzotriazepine |
| SMILES | Fc1ccc2c(c1)C(c1ccccc1)=NNC(c1ccc(Cl)cc1)=N2 |
| InChI | InChI=1S/C20H13ClFN3/c21-15-8-6-14(7-9-15)20-23-18-11-10-16(22)12-17(18)19(24-25-20)13-4-2-1-3-5-13/h1-12H,(H,23,25) |
| InChIKey | XFEAHBAPQDTGSL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |