C20H15ClN4 — CID 135425974
5-(4-chlorophenyl)-7-methyl-2-pyridin-3-yl-3H-1,3,4-benzotriazepine (PubChem CID 135425974) has the molecular formula C20H15ClN4 and a molecular weight of 346.82 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-7-methyl-2-pyridin-3-yl-3H-1,3,4-benzotriazepine.
| Compound Name | 5-(4-chlorophenyl)-7-methyl-2-pyridin-3-yl-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135425974 |
| Molecular Formula | C20H15ClN4 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 5-(4-chlorophenyl)-7-methyl-2-pyridin-3-yl-3H-1,3,4-benzotriazepine |
| SMILES | Cc1ccc2c(c1)C(c1ccc(Cl)cc1)=NNC(c1cccnc1)=N2 |
| InChI | InChI=1S/C20H15ClN4/c1-13-4-9-18-17(11-13)19(14-5-7-16(21)8-6-14)24-25-20(23-18)15-3-2-10-22-12-15/h2-12H,1H3,(H,23,25) |
| InChIKey | LRANSWNIXNSJCX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |