C17H16Cl2N4O2 — CID 134106760
N'-[7-chloro-5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl]acetohydrazide;hydrate (PubChem CID 134106760) has the molecular formula C17H16Cl2N4O2 and a molecular weight of 379.25 g/mol. Its IUPAC name is N'-[7-chloro-5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl]acetohydrazide;hydrate.
| Compound Name | N'-[7-chloro-5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl]acetohydrazide;hydrate |
|---|---|
| PubChem CID | 134106760 |
| Molecular Formula | C17H16Cl2N4O2 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N'-[7-chloro-5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl]acetohydrazide;hydrate |
| SMILES | CC(=O)NNC1=Nc2ccc(Cl)cc2C(c2ccccc2Cl)=NC1.O |
| InChI | InChI=1S/C17H14Cl2N4O.H2O/c1-10(24)22-23-16-9-20-17(12-4-2-3-5-14(12)19)13-8-11(18)6-7-15(13)21-16;/h2-8H,9H2,1H3,(H,21,23)(H,22,24);1H2 |
| InChIKey | RINPTAVIIOFFGJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|