C20H18Cl4N4 — CID 54486573
7-chloro-5-(2-chlorophenyl)-N-(1,5-dichloropentan-2-ylideneamino)-3H-1,4-benzodiazepin-2-amine (PubChem CID 54486573) has the molecular formula C20H18Cl4N4 and a molecular weight of 456.20 g/mol. Its IUPAC name is 7-chloro-5-(2-chlorophenyl)-N-(1,5-dichloropentan-2-ylideneamino)-3H-1,4-benzodiazepin-2-amine.
| Compound Name | 7-chloro-5-(2-chlorophenyl)-N-(1,5-dichloropentan-2-ylideneamino)-3H-1,4-benzodiazepin-2-amine |
|---|---|
| PubChem CID | 54486573 |
| Molecular Formula | C20H18Cl4N4 |
| Molecular Weight | 456.20 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | 7-chloro-5-(2-chlorophenyl)-N-(1,5-dichloropentan-2-ylideneamino)-3H-1,4-benzodiazepin-2-amine |
| SMILES | ClCCCC(CCl)=NNC1=Nc2ccc(Cl)cc2C(c2ccccc2Cl)=NC1 |
| InChI | InChI=1S/C20H18Cl4N4/c21-9-3-4-14(11-22)27-28-19-12-25-20(15-5-1-2-6-17(15)24)16-10-13(23)7-8-18(16)26-19/h1-2,5-8,10H,3-4,9,11-12H2,(H,26,28) |
| InChIKey | XSSUKHQKMSLUJA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.20 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|