C24H26ClN5O2 — CID 54198908
methyl 2-[[5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl]hydrazinylidene]-4-pyrrolidin-1-ylbutanoate (PubChem CID 54198908) has the molecular formula C24H26ClN5O2 and a molecular weight of 451.96 g/mol. Its IUPAC name is methyl 2-[[5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl]hydrazinylidene]-4-pyrrolidin-1-ylbutanoate.
| Compound Name | methyl 2-[[5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl]hydrazinylidene]-4-pyrrolidin-1-ylbutanoate |
|---|---|
| PubChem CID | 54198908 |
| Molecular Formula | C24H26ClN5O2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | methyl 2-[[5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl]hydrazinylidene]-4-pyrrolidin-1-ylbutanoate |
| SMILES | COC(=O)C(CCN1CCCC1)=NNC1=Nc2ccccc2C(c2ccccc2Cl)=NC1 |
| InChI | InChI=1S/C24H26ClN5O2/c1-32-24(31)21(12-15-30-13-6-7-14-30)28-29-22-16-26-23(17-8-2-4-10-19(17)25)18-9-3-5-11-20(18)27-22/h2-5,8-11H,6-7,12-16H2,1H3,(H,27,29) |
| InChIKey | PNVFZNXAZXVCQS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|