C18H14Cl3FN4 — CID 21431454
5-(2-chlorophenyl)-N-(1,3-dichloropropan-2-ylideneamino)-8-fluoro-3H-1,4-benzodiazepin-2-amine (PubChem CID 21431454) has the molecular formula C18H14Cl3FN4 and a molecular weight of 411.70 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-(1,3-dichloropropan-2-ylideneamino)-8-fluoro-3H-1,4-benzodiazepin-2-amine.
| Compound Name | 5-(2-chlorophenyl)-N-(1,3-dichloropropan-2-ylideneamino)-8-fluoro-3H-1,4-benzodiazepin-2-amine |
|---|---|
| PubChem CID | 21431454 |
| Molecular Formula | C18H14Cl3FN4 |
| Molecular Weight | 411.70 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 5-(2-chlorophenyl)-N-(1,3-dichloropropan-2-ylideneamino)-8-fluoro-3H-1,4-benzodiazepin-2-amine |
| SMILES | Fc1ccc2c(c1)N=C(NN=C(CCl)CCl)CN=C2c1ccccc1Cl |
| InChI | InChI=1S/C18H14Cl3FN4/c19-8-12(9-20)25-26-17-10-23-18(13-3-1-2-4-15(13)21)14-6-5-11(22)7-16(14)24-17/h1-7H,8-10H2,(H,24,26) |
| InChIKey | OOQZRXOBYMXNHP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|