C22H21ClF2N4O2 — CID 21441628
tert-butyl (2Z)-2-[[9-chloro-5-(2,6-difluorophenyl)-3H-1,4-benzodiazepin-2-yl]hydrazinylidene]propanoate (PubChem CID 21441628) has the molecular formula C22H21ClF2N4O2 and a molecular weight of 446.89 g/mol. Its IUPAC name is tert-butyl (2Z)-2-[[9-chloro-5-(2,6-difluorophenyl)-3H-1,4-benzodiazepin-2-yl]hydrazinylidene]propanoate.
| Compound Name | tert-butyl (2Z)-2-[[9-chloro-5-(2,6-difluorophenyl)-3H-1,4-benzodiazepin-2-yl]hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 21441628 |
| Molecular Formula | C22H21ClF2N4O2 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | tert-butyl (2Z)-2-[[9-chloro-5-(2,6-difluorophenyl)-3H-1,4-benzodiazepin-2-yl]hydrazinylidene]propanoate |
| SMILES | C/C(=N/NC1=Nc2c(Cl)cccc2C(c2c(F)cccc2F)=NC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H21ClF2N4O2/c1-12(21(30)31-22(2,3)4)28-29-17-11-26-20(18-15(24)9-6-10-16(18)25)13-7-5-8-14(23)19(13)27-17/h5-10H,11H2,1-4H3,(H,27,29)/b28-12- |
| InChIKey | FBKXZKYOXOXAOV-NVJOKUIPSA-N |
| XLogP | 4.81 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|