C14H19ClFN3O3 — CID 108896714
tert-butyl N-(2-aminoethyl)-N-[(2-chloro-6-fluorophenyl)carbamoyl]carbamate (PubChem CID 108896714) has the molecular formula C14H19ClFN3O3 and a molecular weight of 331.78 g/mol. Its IUPAC name is tert-butyl N-(2-aminoethyl)-N-[(2-chloro-6-fluorophenyl)carbamoyl]carbamate.
| Compound Name | tert-butyl N-(2-aminoethyl)-N-[(2-chloro-6-fluorophenyl)carbamoyl]carbamate |
|---|---|
| PubChem CID | 108896714 |
| Molecular Formula | C14H19ClFN3O3 |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | tert-butyl N-(2-aminoethyl)-N-[(2-chloro-6-fluorophenyl)carbamoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCN)C(=O)Nc1c(F)cccc1Cl |
| InChI | InChI=1S/C14H19ClFN3O3/c1-14(2,3)22-13(21)19(8-7-17)12(20)18-11-9(15)5-4-6-10(11)16/h4-6H,7-8,17H2,1-3H3,(H,18,20) |
| InChIKey | JENPDVARNYUOTJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |