C15H22ClN3O4 — CID 108885424
tert-butyl N-(2-aminoethyl)-N-[(4-chlorophenoxy)methylcarbamoyl]carbamate (PubChem CID 108885424) has the molecular formula C15H22ClN3O4 and a molecular weight of 343.81 g/mol. Its IUPAC name is tert-butyl N-(2-aminoethyl)-N-[(4-chlorophenoxy)methylcarbamoyl]carbamate.
| Compound Name | tert-butyl N-(2-aminoethyl)-N-[(4-chlorophenoxy)methylcarbamoyl]carbamate |
|---|---|
| PubChem CID | 108885424 |
| Molecular Formula | C15H22ClN3O4 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | tert-butyl N-(2-aminoethyl)-N-[(4-chlorophenoxy)methylcarbamoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCN)C(=O)NCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H22ClN3O4/c1-15(2,3)23-14(21)19(9-8-17)13(20)18-10-22-12-6-4-11(16)5-7-12/h4-7H,8-10,17H2,1-3H3,(H,18,20) |
| InChIKey | SJEBJRZLCWNSPN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|