About (4-chlorophenoxy)methylcarbamothioic S-acid
(4-chlorophenoxy)methylcarbamothioic S-acid (PubChem CID 88825777) has the molecular formula C8H8ClNO2S
and a molecular weight of 217.68 g/mol. Its IUPAC name is (4-chlorophenoxy)methylcarbamothioic S-acid.
Molecular Properties
| Compound Name | (4-chlorophenoxy)methylcarbamothioic S-acid |
| PubChem CID | 88825777 |
| Molecular Formula | C8H8ClNO2S |
| Molecular Weight | 217.68 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | (4-chlorophenoxy)methylcarbamothioic S-acid |
| SMILES | O=C(S)NCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H8ClNO2S/c9-6-1-3-7(4-2-6)12-5-10-8(11)13/h1-4H,5H2,(H2,10,11,13) |
| InChIKey | PPDMPGWQNPPDOU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.68 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenoxy)methylcarbamothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenoxy)methylcarbamothioic S-acid?
The IUPAC name of (4-chlorophenoxy)methylcarbamothioic S-acid (CID 88825777) is (4-chlorophenoxy)methylcarbamothioic S-acid.
What is the SMILES notation for (4-chlorophenoxy)methylcarbamothioic S-acid?
The canonical SMILES for (4-chlorophenoxy)methylcarbamothioic S-acid is O=C(S)NCOc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenoxy)methylcarbamothioic S-acid?
The InChIKey is PPDMPGWQNPPDOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO2S/c9-6-1-3-7(4-2-6)12-5-10-8(11)13/h1-4H,5H2,(H2,10,11,13).
What are the key properties of (4-chlorophenoxy)methylcarbamothioic S-acid?
(4-chlorophenoxy)methylcarbamothioic S-acid has a molecular weight of 217.68 g/mol, XLogP of 2.32, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenoxy)methylcarbamothioic S-acid is sourced from PubChem (CID 88825777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).