C17H27N3O4 — CID 108879327
tert-butyl N-(2-aminoethyl)-N-[(3,4-dimethylphenoxy)methylcarbamoyl]carbamate (PubChem CID 108879327) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl N-(2-aminoethyl)-N-[(3,4-dimethylphenoxy)methylcarbamoyl]carbamate.
| Compound Name | tert-butyl N-(2-aminoethyl)-N-[(3,4-dimethylphenoxy)methylcarbamoyl]carbamate |
|---|---|
| PubChem CID | 108879327 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | tert-butyl N-(2-aminoethyl)-N-[(3,4-dimethylphenoxy)methylcarbamoyl]carbamate |
| SMILES | Cc1ccc(OCNC(=O)N(CCN)C(=O)OC(C)(C)C)cc1C |
| InChI | InChI=1S/C17H27N3O4/c1-12-6-7-14(10-13(12)2)23-11-19-15(21)20(9-8-18)16(22)24-17(3,4)5/h6-7,10H,8-9,11,18H2,1-5H3,(H,19,21) |
| InChIKey | IQDYJYFUWZEVTR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|