C15H30N4O5 — CID 108864621
tert-butyl N-(2-aminoethyl)-N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]carbamate (PubChem CID 108864621) has the molecular formula C15H30N4O5 and a molecular weight of 346.43 g/mol. Its IUPAC name is tert-butyl N-(2-aminoethyl)-N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]carbamate.
| Compound Name | tert-butyl N-(2-aminoethyl)-N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]carbamate |
|---|---|
| PubChem CID | 108864621 |
| Molecular Formula | C15H30N4O5 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | tert-butyl N-(2-aminoethyl)-N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)N(CCN)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N4O5/c1-14(2,3)23-12(21)18-9-8-17-11(20)19(10-7-16)13(22)24-15(4,5)6/h7-10,16H2,1-6H3,(H,17,20)(H,18,21) |
| InChIKey | YHPAXIIEGSLGMX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|