C14H21N3O6 — CID 108872024
tert-butyl N-(2-aminoethyl)-N-[(3,4,5-trihydroxyphenyl)carbamoyl]carbamate (PubChem CID 108872024) has the molecular formula C14H21N3O6 and a molecular weight of 327.34 g/mol. Its IUPAC name is tert-butyl N-(2-aminoethyl)-N-[(3,4,5-trihydroxyphenyl)carbamoyl]carbamate.
| Compound Name | tert-butyl N-(2-aminoethyl)-N-[(3,4,5-trihydroxyphenyl)carbamoyl]carbamate |
|---|---|
| PubChem CID | 108872024 |
| Molecular Formula | C14H21N3O6 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | tert-butyl N-(2-aminoethyl)-N-[(3,4,5-trihydroxyphenyl)carbamoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCN)C(=O)Nc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C14H21N3O6/c1-14(2,3)23-13(22)17(5-4-15)12(21)16-8-6-9(18)11(20)10(19)7-8/h6-7,18-20H,4-5,15H2,1-3H3,(H,16,21) |
| InChIKey | DVZOYEYNFFICKV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|