C11H15N3O4 — CID 108895560
N-(2-aminoethyl)-N-[(3,5-dihydroxyphenyl)carbamoyl]acetamide (PubChem CID 108895560) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-[(3,5-dihydroxyphenyl)carbamoyl]acetamide.
| Compound Name | N-(2-aminoethyl)-N-[(3,5-dihydroxyphenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 108895560 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-(2-aminoethyl)-N-[(3,5-dihydroxyphenyl)carbamoyl]acetamide |
| SMILES | CC(=O)N(CCN)C(=O)Nc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H15N3O4/c1-7(15)14(3-2-12)11(18)13-8-4-9(16)6-10(17)5-8/h4-6,16-17H,2-3,12H2,1H3,(H,13,18) |
| InChIKey | WGHUPRWJIUCLOO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |