C17H22N4O4 — CID 108873405
N-(2-aminoethyl)-N-[(2-tert-butyl-1,3-dioxoisoindol-5-yl)carbamoyl]acetamide (PubChem CID 108873405) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-[(2-tert-butyl-1,3-dioxoisoindol-5-yl)carbamoyl]acetamide.
| Compound Name | N-(2-aminoethyl)-N-[(2-tert-butyl-1,3-dioxoisoindol-5-yl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 108873405 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-(2-aminoethyl)-N-[(2-tert-butyl-1,3-dioxoisoindol-5-yl)carbamoyl]acetamide |
| SMILES | CC(=O)N(CCN)C(=O)Nc1ccc2c(c1)C(=O)N(C(C)(C)C)C2=O |
| InChI | InChI=1S/C17H22N4O4/c1-10(22)20(8-7-18)16(25)19-11-5-6-12-13(9-11)15(24)21(14(12)23)17(2,3)4/h5-6,9H,7-8,18H2,1-4H3,(H,19,25) |
| InChIKey | ZOJZHBAAQPPKAJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|