C23H27N3O3 — CID 108873183
1-benzyl-3-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-1-propan-2-ylurea (PubChem CID 108873183) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-benzyl-3-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-1-propan-2-ylurea.
| Compound Name | 1-benzyl-3-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-1-propan-2-ylurea |
|---|---|
| PubChem CID | 108873183 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 1-benzyl-3-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-1-propan-2-ylurea |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)Nc1ccc2c(c1)C(=O)N(C(C)(C)C)C2=O |
| InChI | InChI=1S/C23H27N3O3/c1-15(2)25(14-16-9-7-6-8-10-16)22(29)24-17-11-12-18-19(13-17)21(28)26(20(18)27)23(3,4)5/h6-13,15H,14H2,1-5H3,(H,24,29) |
| InChIKey | FKAZNGVTCCQJCX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|