C20H28N4O3 — CID 108873206
3-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-1-methyl-1-(1-methylpiperidin-4-yl)urea (PubChem CID 108873206) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 3-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-1-methyl-1-(1-methylpiperidin-4-yl)urea.
| Compound Name | 3-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-1-methyl-1-(1-methylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 108873206 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 3-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-1-methyl-1-(1-methylpiperidin-4-yl)urea |
| SMILES | CN1CCC(N(C)C(=O)Nc2ccc3c(c2)C(=O)N(C(C)(C)C)C3=O)CC1 |
| InChI | InChI=1S/C20H28N4O3/c1-20(2,3)24-17(25)15-7-6-13(12-16(15)18(24)26)21-19(27)23(5)14-8-10-22(4)11-9-14/h6-7,12,14H,8-11H2,1-5H3,(H,21,27) |
| InChIKey | VYKRDHFSNSZTIY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|