C20H26N4O5 — CID 108873457
ethyl 4-[(2-tert-butyl-1,3-dioxoisoindol-5-yl)carbamoyl]piperazine-1-carboxylate (PubChem CID 108873457) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is ethyl 4-[(2-tert-butyl-1,3-dioxoisoindol-5-yl)carbamoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(2-tert-butyl-1,3-dioxoisoindol-5-yl)carbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108873457 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | ethyl 4-[(2-tert-butyl-1,3-dioxoisoindol-5-yl)carbamoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)Nc2ccc3c(c2)C(=O)N(C(C)(C)C)C3=O)CC1 |
| InChI | InChI=1S/C20H26N4O5/c1-5-29-19(28)23-10-8-22(9-11-23)18(27)21-13-6-7-14-15(12-13)17(26)24(16(14)25)20(2,3)4/h6-7,12H,5,8-11H2,1-4H3,(H,21,27) |
| InChIKey | DTWSUCBSQYIRQR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|