C14H30N4O4 — CID 87350283
tert-butyl N-(2-aminoethyl)-N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]carbamate (PubChem CID 87350283) has the molecular formula C14H30N4O4 and a molecular weight of 318.42 g/mol. Its IUPAC name is tert-butyl N-(2-aminoethyl)-N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]carbamate.
| Compound Name | tert-butyl N-(2-aminoethyl)-N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]carbamate |
|---|---|
| PubChem CID | 87350283 |
| Molecular Formula | C14H30N4O4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | tert-butyl N-(2-aminoethyl)-N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNN(CCN)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H30N4O4/c1-13(2,3)21-11(19)16-8-9-17-18(10-7-15)12(20)22-14(4,5)6/h17H,7-10,15H2,1-6H3,(H,16,19) |
| InChIKey | ROUWNUDOJZCYJY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|