C16H26N4O2 — CID 108879089
4-(2-aminoethyl)-N-[(3,4-dimethylphenoxy)methyl]piperazine-1-carboxamide (PubChem CID 108879089) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-[(3,4-dimethylphenoxy)methyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-aminoethyl)-N-[(3,4-dimethylphenoxy)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108879089 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 4-(2-aminoethyl)-N-[(3,4-dimethylphenoxy)methyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(OCNC(=O)N2CCN(CCN)CC2)cc1C |
| InChI | InChI=1S/C16H26N4O2/c1-13-3-4-15(11-14(13)2)22-12-18-16(21)20-9-7-19(6-5-17)8-10-20/h3-4,11H,5-10,12,17H2,1-2H3,(H,18,21) |
| InChIKey | HTDZZXJSKOIPDF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|