C14H20ClN3O2 — CID 108877852
N-[(4-chloro-3,5-dimethylphenoxy)methyl]piperazine-1-carboxamide (PubChem CID 108877852) has the molecular formula C14H20ClN3O2 and a molecular weight of 297.79 g/mol. Its IUPAC name is N-[(4-chloro-3,5-dimethylphenoxy)methyl]piperazine-1-carboxamide.
| Compound Name | N-[(4-chloro-3,5-dimethylphenoxy)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108877852 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-[(4-chloro-3,5-dimethylphenoxy)methyl]piperazine-1-carboxamide |
| SMILES | Cc1cc(OCNC(=O)N2CCNCC2)cc(C)c1Cl |
| InChI | InChI=1S/C14H20ClN3O2/c1-10-7-12(8-11(2)13(10)15)20-9-17-14(19)18-5-3-16-4-6-18/h7-8,16H,3-6,9H2,1-2H3,(H,17,19) |
| InChIKey | POAFHDCBLAMNTF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|