C16H13ClF2N4 — CID 162346287
[6-chloro-5-(2,6-difluorophenyl)-7-methyl-3H-1,4-benzodiazepin-2-yl]hydrazine (PubChem CID 162346287) has the molecular formula C16H13ClF2N4 and a molecular weight of 334.76 g/mol. Its IUPAC name is [6-chloro-5-(2,6-difluorophenyl)-7-methyl-3H-1,4-benzodiazepin-2-yl]hydrazine.
| Compound Name | [6-chloro-5-(2,6-difluorophenyl)-7-methyl-3H-1,4-benzodiazepin-2-yl]hydrazine |
|---|---|
| PubChem CID | 162346287 |
| Molecular Formula | C16H13ClF2N4 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | [6-chloro-5-(2,6-difluorophenyl)-7-methyl-3H-1,4-benzodiazepin-2-yl]hydrazine |
| SMILES | Cc1ccc2c(c1Cl)C(c1c(F)cccc1F)=NCC(NN)=N2 |
| InChI | InChI=1S/C16H13ClF2N4/c1-8-5-6-11-14(15(8)17)16(21-7-12(22-11)23-20)13-9(18)3-2-4-10(13)19/h2-6H,7,20H2,1H3,(H,22,23) |
| InChIKey | MFNOWNRVRPALGM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|