C16H11ClF2N2S — CID 162346251
6-chloro-5-(2,6-difluorophenyl)-7-methyl-1,3-dihydro-1,4-benzodiazepine-2-thione (PubChem CID 162346251) has the molecular formula C16H11ClF2N2S and a molecular weight of 336.79 g/mol. Its IUPAC name is 6-chloro-5-(2,6-difluorophenyl)-7-methyl-1,3-dihydro-1,4-benzodiazepine-2-thione.
| Compound Name | 6-chloro-5-(2,6-difluorophenyl)-7-methyl-1,3-dihydro-1,4-benzodiazepine-2-thione |
|---|---|
| PubChem CID | 162346251 |
| Molecular Formula | C16H11ClF2N2S |
| Molecular Weight | 336.79 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 6-chloro-5-(2,6-difluorophenyl)-7-methyl-1,3-dihydro-1,4-benzodiazepine-2-thione |
| SMILES | Cc1ccc2c(c1Cl)C(c1c(F)cccc1F)=NCC(=S)N2 |
| InChI | InChI=1S/C16H11ClF2N2S/c1-8-5-6-11-14(15(8)17)16(20-7-12(22)21-11)13-9(18)3-2-4-10(13)19/h2-6H,7H2,1H3,(H,21,22) |
| InChIKey | CRINDPRJWRFHNJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.79 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|